C20H20F3N5O2S — CID 68586906
N-[3-(2-amino-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide (PubChem CID 68586906) has the molecular formula C20H20F3N5O2S and a molecular weight of 451.47 g/mol. Its IUPAC name is N-[3-(2-amino-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-(2-amino-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 68586906 |
| Molecular Formula | C20H20F3N5O2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[3-(2-amino-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-8a-yl)-4-fluorophenyl]-5-(difluoromethyl)pyrazine-2-carboxamide |
| SMILES | CC1SC(N)=NC2(c3cc(NC(=O)c4cnc(C(F)F)cn4)ccc3F)COCCC12 |
| InChI | InChI=1S/C20H20F3N5O2S/c1-10-12-4-5-30-9-20(12,28-19(24)31-10)13-6-11(2-3-14(13)21)27-18(29)16-8-25-15(7-26-16)17(22)23/h2-3,6-8,10,12,17H,4-5,9H2,1H3,(H2,24,28)(H,27,29) |
| InChIKey | ILPCEJBPIIUCNR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |