C14H17FN2OS — CID 143968493
(4R,8aS)-8a-(2-fluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 143968493) has the molecular formula C14H17FN2OS and a molecular weight of 280.37 g/mol. Its IUPAC name is (4R,8aS)-8a-(2-fluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4R,8aS)-8a-(2-fluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 143968493 |
| Molecular Formula | C14H17FN2OS |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (4R,8aS)-8a-(2-fluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1SC(N)=N[C@@]2(c3ccccc3F)COCCC12 |
| InChI | InChI=1S/C14H17FN2OS/c1-9-10-6-7-18-8-14(10,17-13(16)19-9)11-4-2-3-5-12(11)15/h2-5,9-10H,6-8H2,1H3,(H2,16,17)/t9-,10?,14+/m1/s1 |
| InChIKey | WMWGKSSCFRXZOM-YMNNPKDXSA-N |
| XLogP | 2.51 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |