C21H19F2N3OS — CID 118599392
3-[(4R,4aR,6R,8aS)-2-amino-8a-(2,4-difluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]benzonitrile (PubChem CID 118599392) has the molecular formula C21H19F2N3OS and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[(4R,4aR,6R,8aS)-2-amino-8a-(2,4-difluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]benzonitrile.
| Compound Name | 3-[(4R,4aR,6R,8aS)-2-amino-8a-(2,4-difluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 118599392 |
| Molecular Formula | C21H19F2N3OS |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-[(4R,4aR,6R,8aS)-2-amino-8a-(2,4-difluorophenyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]benzonitrile |
| SMILES | C[C@H]1SC(N)=N[C@@]2(c3ccc(F)cc3F)CO[C@@H](c3cccc(C#N)c3)C[C@@H]12 |
| InChI | InChI=1S/C21H19F2N3OS/c1-12-17-9-19(14-4-2-3-13(7-14)10-24)27-11-21(17,26-20(25)28-12)16-6-5-15(22)8-18(16)23/h2-8,12,17,19H,9,11H2,1H3,(H2,25,26)/t12-,17+,19-,21-/m1/s1 |
| InChIKey | WLKLSAZSYORFOL-XDGWSPEVSA-N |
| XLogP | 4.26 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |