C18H19F2N3O2S — CID 91819735
(6R,8aS)-8a-(2,4-difluorophenyl)-6-(4,5-dimethyl-1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 91819735) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is (6R,8aS)-8a-(2,4-difluorophenyl)-6-(4,5-dimethyl-1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (6R,8aS)-8a-(2,4-difluorophenyl)-6-(4,5-dimethyl-1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 91819735 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (6R,8aS)-8a-(2,4-difluorophenyl)-6-(4,5-dimethyl-1,3-oxazol-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | Cc1nc([C@H]2CC3CSC(N)=N[C@@]3(c3ccc(F)cc3F)CO2)oc1C |
| InChI | InChI=1S/C18H19F2N3O2S/c1-9-10(2)25-16(22-9)15-5-11-7-26-17(21)23-18(11,8-24-15)13-4-3-12(19)6-14(13)20/h3-4,6,11,15H,5,7-8H2,1-2H3,(H2,21,23)/t11?,15-,18+/m1/s1 |
| InChIKey | ONVXCGHYMYSNTM-HLSDDEKHSA-N |
| XLogP | 3.60 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |