C19H19F2N3O2S — CID 123147849
5-[2-amino-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1-methylpyridin-2-one (PubChem CID 123147849) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 5-[2-amino-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[2-amino-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 123147849 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-[2-amino-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(C2CC3CSC(N)=NC3(c3ccc(F)cc3F)CO2)ccc1=O |
| InChI | InChI=1S/C19H19F2N3O2S/c1-24-8-11(2-5-17(24)25)16-6-12-9-27-18(22)23-19(12,10-26-16)14-4-3-13(20)7-15(14)21/h2-5,7-8,12,16H,6,9-10H2,1H3,(H2,22,23) |
| InChIKey | BLDFPKAMXFBXMA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |