C17H17F3N4OS — CID 90332363
8a-(2,4-difluorophenyl)-6-(5-fluoro-1-methylpyrazol-3-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 90332363) has the molecular formula C17H17F3N4OS and a molecular weight of 382.41 g/mol. Its IUPAC name is 8a-(2,4-difluorophenyl)-6-(5-fluoro-1-methylpyrazol-3-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | 8a-(2,4-difluorophenyl)-6-(5-fluoro-1-methylpyrazol-3-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 90332363 |
| Molecular Formula | C17H17F3N4OS |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 8a-(2,4-difluorophenyl)-6-(5-fluoro-1-methylpyrazol-3-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | Cn1nc(C2CC3CSC(N)=NC3(c3ccc(F)cc3F)CO2)cc1F |
| InChI | InChI=1S/C17H17F3N4OS/c1-24-15(20)6-13(23-24)14-4-9-7-26-16(21)22-17(9,8-25-14)11-3-2-10(18)5-12(11)19/h2-3,5-6,9,14H,4,7-8H2,1H3,(H2,21,22) |
| InChIKey | YSSIVDQDOKWLPW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |