C17H20F2N2OS — CID 144649597
(6R,8aS)-8a-(2,4-difluorophenyl)-6-(1-methylcyclopropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 144649597) has the molecular formula C17H20F2N2OS and a molecular weight of 338.42 g/mol. Its IUPAC name is (6R,8aS)-8a-(2,4-difluorophenyl)-6-(1-methylcyclopropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (6R,8aS)-8a-(2,4-difluorophenyl)-6-(1-methylcyclopropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 144649597 |
| Molecular Formula | C17H20F2N2OS |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (6R,8aS)-8a-(2,4-difluorophenyl)-6-(1-methylcyclopropyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CC1([C@H]2CC3CSC(N)=N[C@@]3(c3ccc(F)cc3F)CO2)CC1 |
| InChI | InChI=1S/C17H20F2N2OS/c1-16(4-5-16)14-6-10-8-23-15(20)21-17(10,9-22-14)12-3-2-11(18)7-13(12)19/h2-3,7,10,14H,4-6,8-9H2,1H3,(H2,20,21)/t10?,14-,17+/m1/s1 |
| InChIKey | JWGPPHJPNLTEEM-WETSXSAHSA-N |
| XLogP | 3.43 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |