C19H21FIN3OS — CID 121381857
(4R,4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine (PubChem CID 121381857) has the molecular formula C19H21FIN3OS and a molecular weight of 485.37 g/mol. Its IUPAC name is (4R,4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine.
| Compound Name | (4R,4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 121381857 |
| Molecular Formula | C19H21FIN3OS |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | (4R,4aR,6R,9aS)-9a-(2-fluoro-4-iodophenyl)-4-methyl-6-(1,3-oxazol-2-yl)-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[d][1,3]thiazin-2-amine |
| SMILES | C[C@H]1SC(N)=N[C@@]2(c3ccc(I)cc3F)CCC[C@@H](c3ncco3)C[C@@H]12 |
| InChI | InChI=1S/C19H21FIN3OS/c1-11-15-9-12(17-23-7-8-25-17)3-2-6-19(15,24-18(22)26-11)14-5-4-13(21)10-16(14)20/h4-5,7-8,10-12,15H,2-3,6,9H2,1H3,(H2,22,24)/t11-,12-,15+,19-/m1/s1 |
| InChIKey | IPKVDQPJBBWKRC-JFVXACQESA-N |
| XLogP | 5.04 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|