C13H17F2N3S — CID 126488035
(4S,5S,6S)-4-(5-amino-2-fluorophenyl)-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-thiazin-2-amine (PubChem CID 126488035) has the molecular formula C13H17F2N3S and a molecular weight of 285.36 g/mol. Its IUPAC name is (4S,5S,6S)-4-(5-amino-2-fluorophenyl)-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-thiazin-2-amine.
| Compound Name | (4S,5S,6S)-4-(5-amino-2-fluorophenyl)-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 126488035 |
| Molecular Formula | C13H17F2N3S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (4S,5S,6S)-4-(5-amino-2-fluorophenyl)-4-(fluoromethyl)-5,6-dimethyl-5,6-dihydro-1,3-thiazin-2-amine |
| SMILES | C[C@@H]1SC(N)=N[C@](CF)(c2cc(N)ccc2F)[C@@H]1C |
| InChI | InChI=1S/C13H17F2N3S/c1-7-8(2)19-12(17)18-13(7,6-14)10-5-9(16)3-4-11(10)15/h3-5,7-8H,6,16H2,1-2H3,(H2,17,18)/t7-,8+,13+/m1/s1 |
| InChIKey | YJADIQVETLCRIK-UJVNDKKSSA-N |
| XLogP | 2.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|