C14H18FN3OS — CID 58377103
(2Z)-2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-thiazin-6-ylidene]propan-1-ol (PubChem CID 58377103) has the molecular formula C14H18FN3OS and a molecular weight of 295.38 g/mol. Its IUPAC name is (2Z)-2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-thiazin-6-ylidene]propan-1-ol.
| Compound Name | (2Z)-2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-thiazin-6-ylidene]propan-1-ol |
|---|---|
| PubChem CID | 58377103 |
| Molecular Formula | C14H18FN3OS |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2Z)-2-[(4S)-2-amino-4-(5-amino-2-fluorophenyl)-4-methyl-5H-1,3-thiazin-6-ylidene]propan-1-ol |
| SMILES | C/C(CO)=C1\C[C@@](C)(c2cc(N)ccc2F)N=C(N)S1 |
| InChI | InChI=1S/C14H18FN3OS/c1-8(7-19)12-6-14(2,18-13(17)20-12)10-5-9(16)3-4-11(10)15/h3-5,19H,6-7,16H2,1-2H3,(H2,17,18)/b12-8-/t14-/m0/s1 |
| InChIKey | SHHUGBCKSBLJSS-UNJUUPHPSA-N |
| XLogP | 2.34 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|