C12H14FN3O — CID 141279779
(6S)-6-(5-amino-2-fluorophenyl)-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 141279779) has the molecular formula C12H14FN3O and a molecular weight of 235.26 g/mol. Its IUPAC name is (6S)-6-(5-amino-2-fluorophenyl)-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | (6S)-6-(5-amino-2-fluorophenyl)-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 141279779 |
| Molecular Formula | C12H14FN3O |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (6S)-6-(5-amino-2-fluorophenyl)-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CN1C=N[C@](C)(c2cc(N)ccc2F)CC1=O |
| InChI | InChI=1S/C12H14FN3O/c1-12(6-11(17)16(2)7-15-12)9-5-8(14)3-4-10(9)13/h3-5,7H,6,14H2,1-2H3/t12-/m0/s1 |
| InChIKey | PRBVEXUFUFXZJH-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|