C16H22FN3O3 — CID 129388884
tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate (PubChem CID 129388884) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129388884 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | tert-butyl N-[(5R)-5-(5-amino-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@](C)(c2cc(N)ccc2F)COC1 |
| InChI | InChI=1S/C16H22FN3O3/c1-15(2,3)23-14(21)19-13-8-22-9-16(4,20-13)11-7-10(18)5-6-12(11)17/h5-7H,8-9,18H2,1-4H3,(H,19,20,21)/t16-/m0/s1 |
| InChIKey | UPMMKCGAYUVFQZ-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|