C18H25FN4O5S — CID 89036683
tert-butyl N-[(4aS,7S)-4a-(5-amino-2-fluorophenyl)-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-yl]carbamate (PubChem CID 89036683) has the molecular formula C18H25FN4O5S and a molecular weight of 428.49 g/mol. Its IUPAC name is tert-butyl N-[(4aS,7S)-4a-(5-amino-2-fluorophenyl)-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,7S)-4a-(5-amino-2-fluorophenyl)-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 89036683 |
| Molecular Formula | C18H25FN4O5S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | tert-butyl N-[(4aS,7S)-4a-(5-amino-2-fluorophenyl)-2,7-dimethyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-3-yl]carbamate |
| SMILES | C[C@@H]1OC[C@]2(c3cc(N)ccc3F)N=C(NC(=O)OC(C)(C)C)N(C)S(=O)(=O)C12 |
| InChI | InChI=1S/C18H25FN4O5S/c1-10-14-18(9-27-10,12-8-11(20)6-7-13(12)19)22-15(23(5)29(14,25)26)21-16(24)28-17(2,3)4/h6-8,10,14H,9,20H2,1-5H3,(H,21,22,24)/t10-,14?,18+/m0/s1 |
| InChIKey | GLFRZOGQJIXLQY-MCEQOLEDSA-N |
| XLogP | 1.55 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|