C19H27FN4O5S — CID 129201659
tert-butyl N-[4a-(5-amino-2-fluorophenyl)-6-methoxy-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate (PubChem CID 129201659) has the molecular formula C19H27FN4O5S and a molecular weight of 442.51 g/mol. Its IUPAC name is tert-butyl N-[4a-(5-amino-2-fluorophenyl)-6-methoxy-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-6-methoxy-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 129201659 |
| Molecular Formula | C19H27FN4O5S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | tert-butyl N-[4a-(5-amino-2-fluorophenyl)-6-methoxy-2-methyl-1,1-dioxo-5,6,7,7a-tetrahydrocyclopenta[e][1,2,4]thiadiazin-3-yl]carbamate |
| SMILES | COC1CC2C(c3cc(N)ccc3F)(C1)N=C(NC(=O)OC(C)(C)C)N(C)S2(=O)=O |
| InChI | InChI=1S/C19H27FN4O5S/c1-18(2,3)29-17(25)22-16-23-19(13-8-11(21)6-7-14(13)20)10-12(28-5)9-15(19)30(26,27)24(16)4/h6-8,12,15H,9-10,21H2,1-5H3,(H,22,23,25) |
| InChIKey | MMRVQBZEYPUMPD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|