C19H24FN3O5S — CID 70259467
tert-butyl N-[(4aR,6R)-7a-(2-fluoro-5-nitrophenyl)-6-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamate (PubChem CID 70259467) has the molecular formula C19H24FN3O5S and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R)-7a-(2-fluoro-5-nitrophenyl)-6-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,6R)-7a-(2-fluoro-5-nitrophenyl)-6-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 70259467 |
| Molecular Formula | C19H24FN3O5S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | tert-butyl N-[(4aR,6R)-7a-(2-fluoro-5-nitrophenyl)-6-methoxy-4a,5,6,7-tetrahydro-4H-cyclopenta[d][1,3]thiazin-2-yl]carbamate |
| SMILES | CO[C@@H]1C[C@H]2CSC(NC(=O)OC(C)(C)C)=NC2(c2cc([N+](=O)[O-])ccc2F)C1 |
| InChI | InChI=1S/C19H24FN3O5S/c1-18(2,3)28-17(24)21-16-22-19(9-13(27-4)7-11(19)10-29-16)14-8-12(23(25)26)5-6-15(14)20/h5-6,8,11,13H,7,9-10H2,1-4H3,(H,21,22,24)/t11-,13+,19?/m0/s1 |
| InChIKey | BLODWXNRJPDYMT-UXVCLIMPSA-N |
| XLogP | 3.98 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|