C20H27FN4O5S — CID 118281852
tert-butyl N-[(4aS,6S,8aR)-4a-amino-8a-(2-fluoro-5-nitrophenyl)-6-methoxy-5,6,7,8-tetrahydro-4H-3,1-benzothiazin-2-yl]carbamate (PubChem CID 118281852) has the molecular formula C20H27FN4O5S and a molecular weight of 454.52 g/mol. Its IUPAC name is tert-butyl N-[(4aS,6S,8aR)-4a-amino-8a-(2-fluoro-5-nitrophenyl)-6-methoxy-5,6,7,8-tetrahydro-4H-3,1-benzothiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,6S,8aR)-4a-amino-8a-(2-fluoro-5-nitrophenyl)-6-methoxy-5,6,7,8-tetrahydro-4H-3,1-benzothiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 118281852 |
| Molecular Formula | C20H27FN4O5S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | tert-butyl N-[(4aS,6S,8aR)-4a-amino-8a-(2-fluoro-5-nitrophenyl)-6-methoxy-5,6,7,8-tetrahydro-4H-3,1-benzothiazin-2-yl]carbamate |
| SMILES | CO[C@H]1CC[C@]2(c3cc([N+](=O)[O-])ccc3F)N=C(NC(=O)OC(C)(C)C)SC[C@]2(N)C1 |
| InChI | InChI=1S/C20H27FN4O5S/c1-18(2,3)30-17(26)23-16-24-20(14-9-12(25(27)28)5-6-15(14)21)8-7-13(29-4)10-19(20,22)11-31-16/h5-6,9,13H,7-8,10-11,22H2,1-4H3,(H,23,24,26)/t13-,19+,20+/m0/s1 |
| InChIKey | FXEATYOKRDXPIW-CJMONDIMSA-N |
| XLogP | 3.45 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|