C19H22FN3O4S — CID 70915925
tert-butyl N-[4-(2-fluoro-5-nitrophenyl)-4-methyl-6,7-dihydro-5H-cyclopenta[e][1,3]thiazin-2-yl]carbamate (PubChem CID 70915925) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is tert-butyl N-[4-(2-fluoro-5-nitrophenyl)-4-methyl-6,7-dihydro-5H-cyclopenta[e][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(2-fluoro-5-nitrophenyl)-4-methyl-6,7-dihydro-5H-cyclopenta[e][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 70915925 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | tert-butyl N-[4-(2-fluoro-5-nitrophenyl)-4-methyl-6,7-dihydro-5H-cyclopenta[e][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=NC(C)(c2cc([N+](=O)[O-])ccc2F)C2=C(CCC2)S1 |
| InChI | InChI=1S/C19H22FN3O4S/c1-18(2,3)27-17(24)21-16-22-19(4,12-6-5-7-15(12)28-16)13-10-11(23(25)26)8-9-14(13)20/h8-10H,5-7H2,1-4H3,(H,21,22,24) |
| InChIKey | OXNOADMDSSLSFI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|