C19H25N3O5S — CID 58406050
tert-butyl N-[(4aR,8aS)-8a-(2-methyl-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 58406050) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is tert-butyl N-[(4aR,8aS)-8a-(2-methyl-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,8aS)-8a-(2-methyl-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 58406050 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | tert-butyl N-[(4aR,8aS)-8a-(2-methyl-5-nitrophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1[C@]12COCC[C@H]1CSC(NC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C19H25N3O5S/c1-12-5-6-14(22(24)25)9-15(12)19-11-26-8-7-13(19)10-28-16(21-19)20-17(23)27-18(2,3)4/h5-6,9,13H,7-8,10-11H2,1-4H3,(H,20,21,23)/t13-,19-/m0/s1 |
| InChIKey | QZEQVYZPHRYNQV-DJJJIMSYSA-N |
| XLogP | 3.76 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|