C19H26N4O5S — CID 70849419
tert-butyl N-[(4aS,7aR)-4a-amino-7a-(2-methoxy-5-nitrophenyl)-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate (PubChem CID 70849419) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is tert-butyl N-[(4aS,7aR)-4a-amino-7a-(2-methoxy-5-nitrophenyl)-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,7aR)-4a-amino-7a-(2-methoxy-5-nitrophenyl)-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 70849419 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butyl N-[(4aS,7aR)-4a-amino-7a-(2-methoxy-5-nitrophenyl)-4,5,6,7-tetrahydrocyclopenta[d][1,3]thiazin-2-yl]carbamate |
| SMILES | COc1ccc([N+](=O)[O-])cc1[C@]12CCC[C@@]1(N)CSC(NC(=O)OC(C)(C)C)=N2 |
| InChI | InChI=1S/C19H26N4O5S/c1-17(2,3)28-16(24)21-15-22-19(9-5-8-18(19,20)11-29-15)13-10-12(23(25)26)6-7-14(13)27-4/h6-7,10H,5,8-9,11,20H2,1-4H3,(H,21,22,24)/t18-,19-/m1/s1 |
| InChIKey | GPHNUQCFEXXEQM-RTBURBONSA-N |
| XLogP | 3.31 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|