C10H18N2O2S — CID 137450252
tert-butyl N-(4,4-dimethyl-5H-1,3-thiazol-2-yl)carbamate (PubChem CID 137450252) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is tert-butyl N-(4,4-dimethyl-5H-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(4,4-dimethyl-5H-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 137450252 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | tert-butyl N-(4,4-dimethyl-5H-1,3-thiazol-2-yl)carbamate |
| SMILES | CC1(C)CSC(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C10H18N2O2S/c1-9(2,3)14-8(13)11-7-12-10(4,5)6-15-7/h6H2,1-5H3,(H,11,12,13) |
| InChIKey | RWMXBHSFBIPXKV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |