C17H21BrF2N2O2S — CID 163693215
tert-butyl N-[(4S)-4-(5-bromo-2,4-difluorophenyl)-4,6-dimethyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate (PubChem CID 163693215) has the molecular formula C17H21BrF2N2O2S and a molecular weight of 435.33 g/mol. Its IUPAC name is tert-butyl N-[(4S)-4-(5-bromo-2,4-difluorophenyl)-4,6-dimethyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-4-(5-bromo-2,4-difluorophenyl)-4,6-dimethyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 163693215 |
| Molecular Formula | C17H21BrF2N2O2S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | tert-butyl N-[(4S)-4-(5-bromo-2,4-difluorophenyl)-4,6-dimethyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate |
| SMILES | CC1C[C@@](C)(c2cc(Br)c(F)cc2F)N=C(NC(=O)OC(C)(C)C)S1 |
| InChI | InChI=1S/C17H21BrF2N2O2S/c1-9-8-17(5,10-6-11(18)13(20)7-12(10)19)22-14(25-9)21-15(23)24-16(2,3)4/h6-7,9H,8H2,1-5H3,(H,21,22,23)/t9?,17-/m0/s1 |
| InChIKey | JUTDESMCTHVNPJ-XBPAEFMFSA-N |
| XLogP | 5.35 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|