C23H27F2N3O4S — CID 90253336
tert-butyl N-[(4S,6S)-4-(5-acetyl-2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate (PubChem CID 90253336) has the molecular formula C23H27F2N3O4S and a molecular weight of 479.55 g/mol. Its IUPAC name is tert-butyl N-[(4S,6S)-4-(5-acetyl-2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,6S)-4-(5-acetyl-2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 90253336 |
| Molecular Formula | C23H27F2N3O4S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | tert-butyl N-[(4S,6S)-4-(5-acetyl-2,4-difluorophenyl)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-4-methyl-5,6-dihydro-1,3-thiazin-2-yl]carbamate |
| SMILES | CC(=O)c1cc([C@]2(C)C[C@@H](c3c(C)noc3C)SC(NC(=O)OC(C)(C)C)=N2)c(F)cc1F |
| InChI | InChI=1S/C23H27F2N3O4S/c1-11-19(13(3)32-28-11)18-10-23(7,15-8-14(12(2)29)16(24)9-17(15)25)27-20(33-18)26-21(30)31-22(4,5)6/h8-9,18H,10H2,1-7H3,(H,26,27,30)/t18-,23-/m0/s1 |
| InChIKey | MUJMVOHPMNHFRV-MBSDFSHPSA-N |
| XLogP | 5.75 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |