C25H33BF2N2O6S — CID 140892520
methyl (1S,5S,6S)-5-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxylate (PubChem CID 140892520) has the molecular formula C25H33BF2N2O6S and a molecular weight of 538.42 g/mol. Its IUPAC name is methyl (1S,5S,6S)-5-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5S,6S)-5-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 140892520 |
| Molecular Formula | C25H33BF2N2O6S |
| Molecular Weight | 538.42 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | methyl (1S,5S,6S)-5-[2,3-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]12C[C@H]1[C@@](C)(c1cc(B3OC(C)(C)C(C)(C)O3)cc(F)c1F)N=C(NC(=O)OC(C)(C)C)S2 |
| InChI | InChI=1S/C25H33BF2N2O6S/c1-21(2,3)34-20(32)29-19-30-24(8,16-12-25(16,37-19)18(31)33-9)14-10-13(11-15(27)17(14)28)26-35-22(4,5)23(6,7)36-26/h10-11,16H,12H2,1-9H3,(H,29,30,32)/t16-,24+,25-/m0/s1 |
| InChIKey | WNEGNLQYOMLMCQ-CSKMKTBNSA-N |
| XLogP | 4.04 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|