C22H33BFN3O6S — CID 142379359
tert-butyl N-[(5R)-5-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate (PubChem CID 142379359) has the molecular formula C22H33BFN3O6S and a molecular weight of 497.40 g/mol. Its IUPAC name is tert-butyl N-[(5R)-5-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5R)-5-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
|---|---|
| PubChem CID | 142379359 |
| Molecular Formula | C22H33BFN3O6S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | tert-butyl N-[(5R)-5-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-yl]carbamate |
| SMILES | CN1C(NC(=O)OC(C)(C)C)=N[C@](C)(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C22H33BFN3O6S/c1-19(2,3)31-18(28)25-17-26-22(8,13-34(29,30)27(17)9)15-12-14(10-11-16(15)24)23-32-20(4,5)21(6,7)33-23/h10-12H,13H2,1-9H3,(H,25,26,28)/t22-/m0/s1 |
| InChIKey | NXVIEOKNYDFNSH-QFIPXVFZSA-N |
| XLogP | 2.50 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|