C29H43BFN3O8S — CID 142379344
ditert-butyl (2R)-6-amino-8-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-ene-1,2-dicarboxylate (PubChem CID 142379344) has the molecular formula C29H43BFN3O8S and a molecular weight of 623.55 g/mol. Its IUPAC name is ditert-butyl (2R)-6-amino-8-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-ene-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R)-6-amino-8-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142379344 |
| Molecular Formula | C29H43BFN3O8S |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | ditert-butyl (2R)-6-amino-8-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-ene-1,2-dicarboxylate |
| SMILES | CN1C(N)=NC(C)(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)C2(C(C(=O)OC(C)(C)C)[C@@H]2C(=O)OC(C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C29H43BFN3O8S/c1-24(2,3)39-21(35)19-20(22(36)40-25(4,5)6)29(19)28(11,33-23(32)34(12)43(29,37)38)17-15-16(13-14-18(17)31)30-41-26(7,8)27(9,10)42-30/h13-15,19-20H,1-12H3,(H2,32,33)/t19-,20?,28?,29?/m1/s1 |
| InChIKey | JUGPMEKCZBMJCU-NIGHCXEGSA-N |
| XLogP | 2.60 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|