C23H34BFN2O4S — CID 145255343
tert-butyl N-[C-[(3S)-2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylcyclopropyl]sulfanyl-N-methylcarbonimidoyl]carbamate (PubChem CID 145255343) has the molecular formula C23H34BFN2O4S and a molecular weight of 464.41 g/mol. Its IUPAC name is tert-butyl N-[C-[(3S)-2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylcyclopropyl]sulfanyl-N-methylcarbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[C-[(3S)-2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylcyclopropyl]sulfanyl-N-methylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 145255343 |
| Molecular Formula | C23H34BFN2O4S |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | tert-butyl N-[C-[(3S)-2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylcyclopropyl]sulfanyl-N-methylcarbonimidoyl]carbamate |
| SMILES | C/N=C(\NC(=O)OC(C)(C)C)SC1C(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)[C@@H]1C |
| InChI | InChI=1S/C23H34BFN2O4S/c1-13-17(18(13)32-19(26-9)27-20(28)29-21(2,3)4)15-12-14(10-11-16(15)25)24-30-22(5,6)23(7,8)31-24/h10-13,17-18H,1-9H3,(H,26,27,28)/t13-,17?,18?/m0/s1 |
| InChIKey | COPZMHQMRRXRLD-TZYSRNFLSA-N |
| XLogP | 4.47 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|