C29H44BFN2O8S — CID 142379413
tert-butyl N-[(3R)-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 142379413) has the molecular formula C29H44BFN2O8S and a molecular weight of 610.55 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 142379413 |
| Molecular Formula | C29H44BFN2O8S |
| Molecular Weight | 610.55 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | tert-butyl N-[(3R)-3-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=N[C@](C)(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)CS(=O)(=O)C1(C)C |
| InChI | InChI=1S/C29H44BFN2O8S/c1-24(2,3)38-22(34)33(23(35)39-25(4,5)6)21-26(7,8)42(36,37)17-29(13,32-21)19-16-18(14-15-20(19)31)30-40-27(9,10)28(11,12)41-30/h14-16H,17H2,1-13H3/t29-/m0/s1 |
| InChIKey | UVWXWBAYFVEZFX-LJAQVGFWSA-N |
| XLogP | 5.12 |
| TPSA | 120.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|