C21H29BFNO4S — CID 161148890
(7R)-7-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,9-dimethyl-5λ6-thia-8-azaspiro[3.5]non-8-ene 5,5-dioxide (PubChem CID 161148890) has the molecular formula C21H29BFNO4S and a molecular weight of 421.34 g/mol. Its IUPAC name is (7R)-7-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,9-dimethyl-5λ6-thia-8-azaspiro[3.5]non-8-ene 5,5-dioxide.
| Compound Name | (7R)-7-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,9-dimethyl-5λ6-thia-8-azaspiro[3.5]non-8-ene 5,5-dioxide |
|---|---|
| PubChem CID | 161148890 |
| Molecular Formula | C21H29BFNO4S |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (7R)-7-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7,9-dimethyl-5λ6-thia-8-azaspiro[3.5]non-8-ene 5,5-dioxide |
| SMILES | CC1=N[C@](C)(c2cc(B3OC(C)(C)C(C)(C)O3)ccc2F)CS(=O)(=O)C12CCC2 |
| InChI | InChI=1S/C21H29BFNO4S/c1-14-21(10-7-11-21)29(25,26)13-20(6,24-14)16-12-15(8-9-17(16)23)22-27-18(2,3)19(4,5)28-22/h8-9,12H,7,10-11,13H2,1-6H3/t20-/m0/s1 |
| InChIKey | ITWQZRLTQQHXQN-FQEVSTJZSA-N |
| XLogP | 3.15 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|