C26H38IN3O8S — CID 90301449
tert-butyl N-[(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 90301449) has the molecular formula C26H38IN3O8S and a molecular weight of 679.57 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 90301449 |
| Molecular Formula | C26H38IN3O8S |
| Molecular Weight | 679.57 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | tert-butyl N-[(3R)-3-[2-(3-iodopropyl)-5-nitrophenyl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=N[C@](C)(c2cc([N+](=O)[O-])ccc2CCCI)CS(=O)(=O)C1(C)C |
| InChI | InChI=1S/C26H38IN3O8S/c1-23(2,3)37-21(31)29(22(32)38-24(4,5)6)20-25(7,8)39(35,36)16-26(9,28-20)19-15-18(30(33)34)13-12-17(19)11-10-14-27/h12-13,15H,10-11,14,16H2,1-9H3/t26-/m0/s1 |
| InChIKey | CXLCOBJJZMFYAZ-SANMLTNESA-N |
| XLogP | 5.96 |
| TPSA | 145.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|