C19H22F2N2O6 — CID 162048452
tert-butyl 2-[(4aR,7aS)-5-(fluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate (PubChem CID 162048452) has the molecular formula C19H22F2N2O6 and a molecular weight of 412.39 g/mol. Its IUPAC name is tert-butyl 2-[(4aR,7aS)-5-(fluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4aR,7aS)-5-(fluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate |
|---|---|
| PubChem CID | 162048452 |
| Molecular Formula | C19H22F2N2O6 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | tert-butyl 2-[(4aR,7aS)-5-(fluoromethyl)-7a-(2-fluoro-5-nitrophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(c3cc([N+](=O)[O-])ccc3F)COC(CF)[C@H]2CO1 |
| InChI | InChI=1S/C19H22F2N2O6/c1-18(2,3)29-17(24)7-16-22-19(10-28-15(8-20)13(19)9-27-16)12-6-11(23(25)26)4-5-14(12)21/h4-6,13,15H,7-10H2,1-3H3/t13-,15?,19-/m1/s1 |
| InChIKey | YXZYFFUHEKZFSW-LGRPBYAZSA-N |
| XLogP | 3.07 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|