C19H26FN3O3S — CID 90986293
tert-butyl N-[(4aS,5S,7aR)-7a-(5-amino-2-fluorophenyl)-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 90986293) has the molecular formula C19H26FN3O3S and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-[(4aS,5S,7aR)-7a-(5-amino-2-fluorophenyl)-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,5S,7aR)-7a-(5-amino-2-fluorophenyl)-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 90986293 |
| Molecular Formula | C19H26FN3O3S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | tert-butyl N-[(4aS,5S,7aR)-7a-(5-amino-2-fluorophenyl)-5-ethyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC[C@@H]1OC[C@@]2(c3cc(N)ccc3F)N=C(NC(=O)OC(C)(C)C)SC[C@H]12 |
| InChI | InChI=1S/C19H26FN3O3S/c1-5-15-13-9-27-16(22-17(24)26-18(2,3)4)23-19(13,10-25-15)12-8-11(21)6-7-14(12)20/h6-8,13,15H,5,9-10,21H2,1-4H3,(H,22,23,24)/t13-,15+,19+/m1/s1 |
| InChIKey | ITXMWWSZECDXGY-WTANOLMUSA-N |
| XLogP | 3.66 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|