C17H20BrFN2O3S — CID 135137348
tert-butyl N-[(4aS,7aS)-7a-(5-bromo-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 135137348) has the molecular formula C17H20BrFN2O3S and a molecular weight of 431.33 g/mol. Its IUPAC name is tert-butyl N-[(4aS,7aS)-7a-(5-bromo-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aS,7aS)-7a-(5-bromo-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 135137348 |
| Molecular Formula | C17H20BrFN2O3S |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | tert-butyl N-[(4aS,7aS)-7a-(5-bromo-2-fluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1=N[C@@]2(c3cc(Br)ccc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C17H20BrFN2O3S/c1-16(2,3)24-15(22)20-14-21-17(9-23-7-10(17)8-25-14)12-6-11(18)4-5-13(12)19/h4-6,10H,7-9H2,1-3H3,(H,20,21,22)/t10-,17-/m0/s1 |
| InChIKey | PSBKOBLKAGWZSG-BTDLBPIBSA-N |
| XLogP | 4.06 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |