C19H24FN3O6S — CID 67477647
tert-butyl N-[7a-(2-fluoro-5-nitrophenyl)-5-(methoxymethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate (PubChem CID 67477647) has the molecular formula C19H24FN3O6S and a molecular weight of 441.48 g/mol. Its IUPAC name is tert-butyl N-[7a-(2-fluoro-5-nitrophenyl)-5-(methoxymethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate.
| Compound Name | tert-butyl N-[7a-(2-fluoro-5-nitrophenyl)-5-(methoxymethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
|---|---|
| PubChem CID | 67477647 |
| Molecular Formula | C19H24FN3O6S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tert-butyl N-[7a-(2-fluoro-5-nitrophenyl)-5-(methoxymethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]carbamate |
| SMILES | COCC1OCC2(c3cc([N+](=O)[O-])ccc3F)N=C(NC(=O)OC(C)(C)C)SCC12 |
| InChI | InChI=1S/C19H24FN3O6S/c1-18(2,3)29-17(24)21-16-22-19(10-28-15(8-27-4)13(19)9-30-16)12-7-11(23(25)26)5-6-14(12)20/h5-7,13,15H,8-10H2,1-4H3,(H,21,22,24) |
| InChIKey | UFLYWOPROJJJDT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|