C21H20FN3O4S — CID 68589859
N-[(4aR,5S,8aS)-8a-(2-fluoro-5-nitrophenyl)-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 68589859) has the molecular formula C21H20FN3O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[(4aR,5S,8aS)-8a-(2-fluoro-5-nitrophenyl)-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,5S,8aS)-8a-(2-fluoro-5-nitrophenyl)-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 68589859 |
| Molecular Formula | C21H20FN3O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[(4aR,5S,8aS)-8a-(2-fluoro-5-nitrophenyl)-5-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C[C@@H]1COC[C@]2(c3cc([N+](=O)[O-])ccc3F)N=C(NC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C21H20FN3O4S/c1-13-10-29-12-21(16-9-15(25(27)28)7-8-18(16)22)17(13)11-30-20(24-21)23-19(26)14-5-3-2-4-6-14/h2-9,13,17H,10-12H2,1H3,(H,23,24,26)/t13-,17-,21-/m1/s1 |
| InChIKey | RLMAPIZTLXGIAJ-QKAVXHIFSA-N |
| XLogP | 3.74 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|