C21H17F4N3O3S — CID 88949631
N-[7a-[2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 88949631) has the molecular formula C21H17F4N3O3S and a molecular weight of 467.44 g/mol. Its IUPAC name is N-[7a-[2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[7a-[2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 88949631 |
| Molecular Formula | C21H17F4N3O3S |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[7a-[2-fluoro-5-[(2,2,2-trifluoroacetyl)amino]phenyl]-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1=NC2(c3cc(NC(=O)C(F)(F)F)ccc3F)COCC2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H17F4N3O3S/c22-16-7-6-14(26-18(30)21(23,24)25)8-15(16)20-11-31-9-13(20)10-32-19(28-20)27-17(29)12-4-2-1-3-5-12/h1-8,13H,9-11H2,(H,26,30)(H,27,28,29) |
| InChIKey | GESLEXWPXYGDGG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |