C21H18BrFN2O2S — CID 152739445
N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-ethenyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 152739445) has the molecular formula C21H18BrFN2O2S and a molecular weight of 461.36 g/mol. Its IUPAC name is N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-ethenyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-ethenyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 152739445 |
| Molecular Formula | C21H18BrFN2O2S |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | N-[(4aS,5S,7aS)-7a-(5-bromo-2-fluorophenyl)-5-ethenyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C=C[C@@H]1OC[C@]2(c3cc(Br)ccc3F)N=C(NC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C21H18BrFN2O2S/c1-2-18-16-11-28-20(24-19(26)13-6-4-3-5-7-13)25-21(16,12-27-18)15-10-14(22)8-9-17(15)23/h2-10,16,18H,1,11-12H2,(H,24,25,26)/t16-,18+,21-/m1/s1 |
| InChIKey | ZZHJQLTWUZKZLV-PLMTUMEDSA-N |
| XLogP | 4.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|