C21H18BrF3N2O2S — CID 86762640
N-[(4aR,6R,8aS)-8a-(5-bromo-2,4-difluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 86762640) has the molecular formula C21H18BrF3N2O2S and a molecular weight of 499.35 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8a-(5-bromo-2,4-difluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,6R,8aS)-8a-(5-bromo-2,4-difluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 86762640 |
| Molecular Formula | C21H18BrF3N2O2S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | N-[(4aR,6R,8aS)-8a-(5-bromo-2,4-difluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1=N[C@@]2(c3cc(Br)c(F)cc3F)CO[C@@H](CF)C[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H18BrF3N2O2S/c22-16-7-15(17(24)8-18(16)25)21-11-29-14(9-23)6-13(21)10-30-20(27-21)26-19(28)12-4-2-1-3-5-12/h1-5,7-8,13-14H,6,9-11H2,(H,26,27,28)/t13-,14+,21-/m0/s1 |
| InChIKey | NEQYQOHJODPTQI-QTCYRWPVSA-N |
| XLogP | 4.83 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|