C23H24F3N3O2S — CID 123486265
N-[8a-[2,4-difluoro-5-(methylaminomethyl)phenyl]-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 123486265) has the molecular formula C23H24F3N3O2S and a molecular weight of 463.53 g/mol. Its IUPAC name is N-[8a-[2,4-difluoro-5-(methylaminomethyl)phenyl]-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[8a-[2,4-difluoro-5-(methylaminomethyl)phenyl]-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 123486265 |
| Molecular Formula | C23H24F3N3O2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[8a-[2,4-difluoro-5-(methylaminomethyl)phenyl]-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | CNCc1cc(C23COC(CF)CC2CSC(NC(=O)c2ccccc2)=N3)c(F)cc1F |
| InChI | InChI=1S/C23H24F3N3O2S/c1-27-11-15-7-18(20(26)9-19(15)25)23-13-31-17(10-24)8-16(23)12-32-22(29-23)28-21(30)14-5-3-2-4-6-14/h2-7,9,16-17,27H,8,10-13H2,1H3,(H,28,29,30) |
| InChIKey | DVHIASBJSLPENA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |