C23H18F2N2O3S — CID 123172900
N-[8a-(2,4-difluorophenyl)-6-prop-2-ynoyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 123172900) has the molecular formula C23H18F2N2O3S and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[8a-(2,4-difluorophenyl)-6-prop-2-ynoyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[8a-(2,4-difluorophenyl)-6-prop-2-ynoyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 123172900 |
| Molecular Formula | C23H18F2N2O3S |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-[8a-(2,4-difluorophenyl)-6-prop-2-ynoyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C#CC(=O)C1CC2CSC(NC(=O)c3ccccc3)=NC2(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C23H18F2N2O3S/c1-2-19(28)20-10-15-12-31-22(26-21(29)14-6-4-3-5-7-14)27-23(15,13-30-20)17-9-8-16(24)11-18(17)25/h1,3-9,11,15,20H,10,12-13H2,(H,26,27,29) |
| InChIKey | RKXOOYYABHVYKW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|