C24H20F2N4O4S — CID 123872687
2-[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1,3-oxazole-4-carboxamide (PubChem CID 123872687) has the molecular formula C24H20F2N4O4S and a molecular weight of 498.51 g/mol. Its IUPAC name is 2-[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 123872687 |
| Molecular Formula | C24H20F2N4O4S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(C2CC3CSC(NC(=O)c4ccccc4)=NC3(c3ccc(F)cc3F)CO2)n1 |
| InChI | InChI=1S/C24H20F2N4O4S/c25-15-6-7-16(17(26)9-15)24-12-34-19(22-28-18(10-33-22)20(27)31)8-14(24)11-35-23(30-24)29-21(32)13-4-2-1-3-5-13/h1-7,9-10,14,19H,8,11-12H2,(H2,27,31)(H,29,30,32) |
| InChIKey | APMHNRYONWCFNR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |