C27H24F2N2O2S — CID 123560663
N-[8a-(2,4-difluorophenyl)-4-methyl-6-phenyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 123560663) has the molecular formula C27H24F2N2O2S and a molecular weight of 478.56 g/mol. Its IUPAC name is N-[8a-(2,4-difluorophenyl)-4-methyl-6-phenyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[8a-(2,4-difluorophenyl)-4-methyl-6-phenyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 123560663 |
| Molecular Formula | C27H24F2N2O2S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[8a-(2,4-difluorophenyl)-4-methyl-6-phenyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | CC1SC(NC(=O)c2ccccc2)=NC2(c3ccc(F)cc3F)COC(c3ccccc3)CC12 |
| InChI | InChI=1S/C27H24F2N2O2S/c1-17-22-15-24(18-8-4-2-5-9-18)33-16-27(22,21-13-12-20(28)14-23(21)29)31-26(34-17)30-25(32)19-10-6-3-7-11-19/h2-14,17,22,24H,15-16H2,1H3,(H,30,31,32) |
| InChIKey | WZFIIKOMTMAHCA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |