C25H24F2N2O5S — CID 90331856
ethyl 3-[(4aR,6R,8aS)-2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-3-oxopropanoate (PubChem CID 90331856) has the molecular formula C25H24F2N2O5S and a molecular weight of 502.54 g/mol. Its IUPAC name is ethyl 3-[(4aR,6R,8aS)-2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[(4aR,6R,8aS)-2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 90331856 |
| Molecular Formula | C25H24F2N2O5S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 3-[(4aR,6R,8aS)-2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-6-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)[C@H]1C[C@H]2CSC(NC(=O)c3ccccc3)=N[C@@]2(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C25H24F2N2O5S/c1-2-33-22(31)12-20(30)21-10-16-13-35-24(28-23(32)15-6-4-3-5-7-15)29-25(16,14-34-21)18-9-8-17(26)11-19(18)27/h3-9,11,16,21H,2,10,12-14H2,1H3,(H,28,29,32)/t16-,21+,25-/m0/s1 |
| InChIKey | IPERLBHMKTYWJB-LMNXFLSBSA-N |
| XLogP | 3.62 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|