C26H28F2N4O5S — CID 123463338
tert-butyl N-[[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carbonyl]amino]carbamate (PubChem CID 123463338) has the molecular formula C26H28F2N4O5S and a molecular weight of 546.60 g/mol. Its IUPAC name is tert-butyl N-[[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 123463338 |
| Molecular Formula | C26H28F2N4O5S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | tert-butyl N-[[2-benzamido-8a-(2,4-difluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carbonyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C1CC2CSC(NC(=O)c3ccccc3)=NC2(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C26H28F2N4O5S/c1-25(2,3)37-24(35)32-31-22(34)20-11-16-13-38-23(29-21(33)15-7-5-4-6-8-15)30-26(16,14-36-20)18-10-9-17(27)12-19(18)28/h4-10,12,16,20H,11,13-14H2,1-3H3,(H,31,34)(H,32,35)(H,29,30,33) |
| InChIKey | QEKBJGKLTSUYTG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|