C26H29F2N3O5S — CID 123884711
2-benzamido-8a-(2,4-difluorophenyl)-N-(2,2-dimethoxyethyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carboxamide (PubChem CID 123884711) has the molecular formula C26H29F2N3O5S and a molecular weight of 533.60 g/mol. Its IUPAC name is 2-benzamido-8a-(2,4-difluorophenyl)-N-(2,2-dimethoxyethyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carboxamide.
| Compound Name | 2-benzamido-8a-(2,4-difluorophenyl)-N-(2,2-dimethoxyethyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carboxamide |
|---|---|
| PubChem CID | 123884711 |
| Molecular Formula | C26H29F2N3O5S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-benzamido-8a-(2,4-difluorophenyl)-N-(2,2-dimethoxyethyl)-4-methyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazine-6-carboxamide |
| SMILES | COC(CNC(=O)C1CC2C(C)SC(NC(=O)c3ccccc3)=NC2(c2ccc(F)cc2F)CO1)OC |
| InChI | InChI=1S/C26H29F2N3O5S/c1-15-19-12-21(24(33)29-13-22(34-2)35-3)36-14-26(19,18-10-9-17(27)11-20(18)28)31-25(37-15)30-23(32)16-7-5-4-6-8-16/h4-11,15,19,21-22H,12-14H2,1-3H3,(H,29,33)(H,30,31,32) |
| InChIKey | SWENDTNLFNVMKR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|