C27H18F5N5O4S2 — CID 135125569
N-[(4aS,5S,7aS)-7a-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-5-(trifluoromethylsulfonyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 135125569) has the molecular formula C27H18F5N5O4S2 and a molecular weight of 635.60 g/mol. Its IUPAC name is N-[(4aS,5S,7aS)-7a-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-5-(trifluoromethylsulfonyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,5S,7aS)-7a-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-5-(trifluoromethylsulfonyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 135125569 |
| Molecular Formula | C27H18F5N5O4S2 |
| Molecular Weight | 635.60 g/mol |
| Exact Mass | 635.07 |
| IUPAC Name | N-[(4aS,5S,7aS)-7a-[5-[(Z)-2-(5-cyanopyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-5-(trifluoromethylsulfonyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | N#Cc1cnc(/C(F)=C/c2ccc(F)c([C@]34CO[C@@H](S(=O)(=O)C(F)(F)F)[C@@H]3CSC(NC(=O)c3ccccc3)=N4)c2)cn1 |
| InChI | InChI=1S/C27H18F5N5O4S2/c28-20-7-6-15(9-21(29)22-12-34-17(10-33)11-35-22)8-18(20)26-14-41-24(43(39,40)27(30,31)32)19(26)13-42-25(37-26)36-23(38)16-4-2-1-3-5-16/h1-9,11-12,19,24H,13-14H2,(H,36,37,38)/b21-9-/t19-,24-,26+/m0/s1 |
| InChIKey | JUSBFOVXYZFMBU-SKFGEQILSA-N |
| XLogP | 4.59 |
| TPSA | 134.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |