C33H31F2N5O4S — CID 154944479
tert-butyl (4aS,7aS)-2-benzamido-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate (PubChem CID 154944479) has the molecular formula C33H31F2N5O4S and a molecular weight of 631.71 g/mol. Its IUPAC name is tert-butyl (4aS,7aS)-2-benzamido-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate.
| Compound Name | tert-butyl (4aS,7aS)-2-benzamido-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
|---|---|
| PubChem CID | 154944479 |
| Molecular Formula | C33H31F2N5O4S |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | tert-butyl (4aS,7aS)-2-benzamido-7a-[2-fluoro-5-[(Z)-2-fluoro-2-(5-prop-2-ynoxypyrazin-2-yl)ethenyl]phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazine-6-carboxylate |
| SMILES | C#CCOc1cnc(/C(F)=C/c2ccc(F)c([C@]34CN(C(=O)OC(C)(C)C)C[C@@H]3CSC(NC(=O)c3ccccc3)=N4)c2)cn1 |
| InChI | InChI=1S/C33H31F2N5O4S/c1-5-13-43-28-17-36-27(16-37-28)26(35)15-21-11-12-25(34)24(14-21)33-20-40(31(42)44-32(2,3)4)18-23(33)19-45-30(39-33)38-29(41)22-9-7-6-8-10-22/h1,6-12,14-17,23H,13,18-20H2,2-4H3,(H,38,39,41)/b26-15-/t23-,33+/m1/s1 |
| InChIKey | NJLUXSHTLLOLED-JNHJPJDMSA-N |
| XLogP | 5.69 |
| TPSA | 106.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|