C20H19F2N5OS — CID 90068826
N-[(4aR,7aS)-6-carbamimidoyl-7a-(2,5-difluorophenyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 90068826) has the molecular formula C20H19F2N5OS and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[(4aR,7aS)-6-carbamimidoyl-7a-(2,5-difluorophenyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aS)-6-carbamimidoyl-7a-(2,5-difluorophenyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 90068826 |
| Molecular Formula | C20H19F2N5OS |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[(4aR,7aS)-6-carbamimidoyl-7a-(2,5-difluorophenyl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | [H]/N=C(\N)N1C[C@H]2CSC(NC(=O)c3ccccc3)=N[C@@]2(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C20H19F2N5OS/c21-14-6-7-16(22)15(8-14)20-11-27(18(23)24)9-13(20)10-29-19(26-20)25-17(28)12-4-2-1-3-5-12/h1-8,13H,9-11H2,(H3,23,24)(H,25,26,28)/t13-,20-/m0/s1 |
| InChIKey | HABQJZAHLQODLK-RBZFPXEDSA-N |
| XLogP | 2.52 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|