C29H31F2N5O3S — CID 123247728
N-[6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(2-methylpropoxy)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 123247728) has the molecular formula C29H31F2N5O3S and a molecular weight of 567.66 g/mol. Its IUPAC name is N-[6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(2-methylpropoxy)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(2-methylpropoxy)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 123247728 |
| Molecular Formula | C29H31F2N5O3S |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | N-[6-(5-fluoro-4-methoxy-6-methylpyrimidin-2-yl)-7a-[2-fluoro-5-(2-methylpropoxy)phenyl]-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | COc1nc(N2CC3CSC(NC(=O)c4ccccc4)=NC3(c3cc(OCC(C)C)ccc3F)C2)nc(C)c1F |
| InChI | InChI=1S/C29H31F2N5O3S/c1-17(2)14-39-21-10-11-23(30)22(12-21)29-16-36(27-32-18(3)24(31)26(34-27)38-4)13-20(29)15-40-28(35-29)33-25(37)19-8-6-5-7-9-19/h5-12,17,20H,13-16H2,1-4H3,(H,33,35,37) |
| InChIKey | BWMDONAYWKQRSJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |