C21H17F2N5OS2 — CID 86762234
N-[(4aR,7aR)-6-(5-fluoropyrimidin-2-yl)-7a-(5-fluorothiophen-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 86762234) has the molecular formula C21H17F2N5OS2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[(4aR,7aR)-6-(5-fluoropyrimidin-2-yl)-7a-(5-fluorothiophen-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aR)-6-(5-fluoropyrimidin-2-yl)-7a-(5-fluorothiophen-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 86762234 |
| Molecular Formula | C21H17F2N5OS2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-[(4aR,7aR)-6-(5-fluoropyrimidin-2-yl)-7a-(5-fluorothiophen-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | O=C(NC1=N[C@@]2(c3ccc(F)s3)CN(c3ncc(F)cn3)C[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H17F2N5OS2/c22-15-8-24-19(25-9-15)28-10-14-11-30-20(26-18(29)13-4-2-1-3-5-13)27-21(14,12-28)16-6-7-17(23)31-16/h1-9,14H,10-12H2,(H,26,27,29)/t14-,21-/m0/s1 |
| InChIKey | XWKAATKAVFBPDY-QKKBWIMNSA-N |
| XLogP | 3.68 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |