C29H22F3N7O2S — CID 123504750
N-[3-[2-benzamido-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide (PubChem CID 123504750) has the molecular formula C29H22F3N7O2S and a molecular weight of 589.60 g/mol. Its IUPAC name is N-[3-[2-benzamido-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-[3-[2-benzamido-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 123504750 |
| Molecular Formula | C29H22F3N7O2S |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | N-[3-[2-benzamido-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]phenyl]-3,5-difluoropyridine-2-carboxamide |
| SMILES | O=C(NC1=NC2(c3cccc(NC(=O)c4ncc(F)cc4F)c3)CN(c3ncc(F)cn3)CC2CS1)c1ccccc1 |
| InChI | InChI=1S/C29H22F3N7O2S/c30-20-10-23(32)24(33-11-20)26(41)36-22-8-4-7-18(9-22)29-16-39(27-34-12-21(31)13-35-27)14-19(29)15-42-28(38-29)37-25(40)17-5-2-1-3-6-17/h1-13,19H,14-16H2,(H,36,41)(H,37,38,40) |
| InChIKey | BUDDHIQMASVWNE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |